C11H12O4 — CID 134868421
(5-formyl-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 134868421) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is (5-formyl-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (5-formyl-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 134868421 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | (5-formyl-1,3-dimethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | CC(=O)OC1(C)C=C(C)C=C(C=O)C1=O |
| InChI | InChI=1S/C11H12O4/c1-7-4-9(6-12)10(14)11(3,5-7)15-8(2)13/h4-6H,1-3H3 |
| InChIKey | MWASGGOONNTTOV-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|