C19H32O2 — CID 151363908
1-phenyl-2-propan-2-yldecane-1,1-diol (PubChem CID 151363908) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-phenyl-2-propan-2-yldecane-1,1-diol.
| Compound Name | 1-phenyl-2-propan-2-yldecane-1,1-diol |
|---|---|
| PubChem CID | 151363908 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-phenyl-2-propan-2-yldecane-1,1-diol |
| SMILES | CCCCCCCCC(C(C)C)C(O)(O)c1ccccc1 |
| InChI | InChI=1S/C19H32O2/c1-4-5-6-7-8-12-15-18(16(2)3)19(20,21)17-13-10-9-11-14-17/h9-11,13-14,16,18,20-21H,4-8,12,15H2,1-3H3 |
| InChIKey | OPAOHULOZFCKER-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|