C17H29NO — CID 62373527
1-(octan-2-ylamino)-2-phenylpropan-2-ol (PubChem CID 62373527) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is 1-(octan-2-ylamino)-2-phenylpropan-2-ol.
| Compound Name | 1-(octan-2-ylamino)-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 62373527 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 1-(octan-2-ylamino)-2-phenylpropan-2-ol |
| SMILES | CCCCCCC(C)NCC(C)(O)c1ccccc1 |
| InChI | InChI=1S/C17H29NO/c1-4-5-6-8-11-15(2)18-14-17(3,19)16-12-9-7-10-13-16/h7,9-10,12-13,15,18-19H,4-6,8,11,14H2,1-3H3 |
| InChIKey | TXHNBZWDVUJXRB-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|