About methyl phenacyl hydrogen phosphate
methyl phenacyl hydrogen phosphate (PubChem CID 151367675) has the molecular formula C9H11O5P
and a molecular weight of 230.16 g/mol. Its IUPAC name is methyl phenacyl hydrogen phosphate.
Molecular Properties
| Compound Name | methyl phenacyl hydrogen phosphate |
| PubChem CID | 151367675 |
| Molecular Formula | C9H11O5P |
| Molecular Weight | 230.16 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | methyl phenacyl hydrogen phosphate |
| SMILES | COP(=O)(O)OCC(=O)c1ccccc1 |
| InChI | InChI=1S/C9H11O5P/c1-13-15(11,12)14-7-9(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,12) |
| InChIKey | OPTRCULTCQVGHN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl phenacyl hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl phenacyl hydrogen phosphate?
The IUPAC name of methyl phenacyl hydrogen phosphate (CID 151367675) is methyl phenacyl hydrogen phosphate.
What is the SMILES notation for methyl phenacyl hydrogen phosphate?
The canonical SMILES for methyl phenacyl hydrogen phosphate is COP(=O)(O)OCC(=O)c1ccccc1.
What is the InChIKey of methyl phenacyl hydrogen phosphate?
The InChIKey is OPTRCULTCQVGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O5P/c1-13-15(11,12)14-7-9(10)8-5-3-2-4-6-8/h2-6H,7H2,1H3,(H,11,12).
What are the key properties of methyl phenacyl hydrogen phosphate?
methyl phenacyl hydrogen phosphate has a molecular weight of 230.16 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl phenacyl hydrogen phosphate is sourced from PubChem (CID 151367675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).