C20H17NO3 — CID 151393349
(2,2-diphenyl-4H-[1,3]dioxino[5,4-b]pyridin-6-yl)methanol (PubChem CID 151393349) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2,2-diphenyl-4H-[1,3]dioxino[5,4-b]pyridin-6-yl)methanol.
| Compound Name | (2,2-diphenyl-4H-[1,3]dioxino[5,4-b]pyridin-6-yl)methanol |
|---|---|
| PubChem CID | 151393349 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2,2-diphenyl-4H-[1,3]dioxino[5,4-b]pyridin-6-yl)methanol |
| SMILES | OCc1ccc2c(n1)COC(c1ccccc1)(c1ccccc1)O2 |
| InChI | InChI=1S/C20H17NO3/c22-13-17-11-12-19-18(21-17)14-23-20(24-19,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-12,22H,13-14H2 |
| InChIKey | OUXORRVDTCPDGU-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |