C9H20O2Si — CID 15139772
(2S)-2-[(3S,4R)-2,2,4-trimethyloxasilolan-3-yl]propan-1-ol (PubChem CID 15139772) has the molecular formula C9H20O2Si and a molecular weight of 188.34 g/mol. Its IUPAC name is (2S)-2-[(3S,4R)-2,2,4-trimethyloxasilolan-3-yl]propan-1-ol.
| Compound Name | (2S)-2-[(3S,4R)-2,2,4-trimethyloxasilolan-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 15139772 |
| Molecular Formula | C9H20O2Si |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (2S)-2-[(3S,4R)-2,2,4-trimethyloxasilolan-3-yl]propan-1-ol |
| SMILES | C[C@@H]1CO[Si](C)(C)[C@H]1[C@@H](C)CO |
| InChI | InChI=1S/C9H20O2Si/c1-7(5-10)9-8(2)6-11-12(9,3)4/h7-10H,5-6H2,1-4H3/t7-,8+,9-/m0/s1 |
| InChIKey | KXGWPIXRTSPZDA-YIZRAAEISA-N |
| XLogP | 1.86 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|