C23H31N3O2 — CID 151401393
3-(benzotriazol-2-yl)-6-(2-propyloctyl)benzene-1,2-diol (PubChem CID 151401393) has the molecular formula C23H31N3O2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 3-(benzotriazol-2-yl)-6-(2-propyloctyl)benzene-1,2-diol.
| Compound Name | 3-(benzotriazol-2-yl)-6-(2-propyloctyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 151401393 |
| Molecular Formula | C23H31N3O2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | 3-(benzotriazol-2-yl)-6-(2-propyloctyl)benzene-1,2-diol |
| SMILES | CCCCCCC(CCC)Cc1ccc(-n2nc3ccccc3n2)c(O)c1O |
| InChI | InChI=1S/C23H31N3O2/c1-3-5-6-7-11-17(10-4-2)16-18-14-15-21(23(28)22(18)27)26-24-19-12-8-9-13-20(19)25-26/h8-9,12-15,17,27-28H,3-7,10-11,16H2,1-2H3 |
| InChIKey | OWOFMKZCMMXGII-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|