C37H30N8O3 — CID 151413919
2,4-bis[3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]phenyl]pentan-3-one (PubChem CID 151413919) has the molecular formula C37H30N8O3 and a molecular weight of 634.70 g/mol. Its IUPAC name is 2,4-bis[3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 151413919 |
| Molecular Formula | C37H30N8O3 |
| Molecular Weight | 634.70 g/mol |
| Exact Mass | 634.24 |
| IUPAC Name | 2,4-bis[3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1cccc(-c2cnc(N)c(C(=O)c3cccnc3)n2)c1)c1cccc(-c2cnc(N)c(C(=O)c3cccnc3)n2)c1 |
| InChI | InChI=1S/C37H30N8O3/c1-21(23-7-3-9-25(15-23)29-19-42-36(38)31(44-29)34(47)27-11-5-13-40-17-27)33(46)22(2)24-8-4-10-26(16-24)30-20-43-37(39)32(45-30)35(48)28-12-6-14-41-18-28/h3-22H,1-2H3,(H2,38,42)(H2,39,43) |
| InChIKey | OZCFZZAOALYOLJ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 180.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.70 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |