C22H24ClN5O4S — CID 142785944
3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]-6-chloro-1-(4-hydroxycyclohexyl)cyclohexa-2,4-diene-1-sulfonamide (PubChem CID 142785944) has the molecular formula C22H24ClN5O4S and a molecular weight of 489.99 g/mol. Its IUPAC name is 3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]-6-chloro-1-(4-hydroxycyclohexyl)cyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]-6-chloro-1-(4-hydroxycyclohexyl)cyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 142785944 |
| Molecular Formula | C22H24ClN5O4S |
| Molecular Weight | 489.99 g/mol |
| Exact Mass | 489.12 |
| IUPAC Name | 3-[5-amino-6-(pyridine-3-carbonyl)pyrazin-2-yl]-6-chloro-1-(4-hydroxycyclohexyl)cyclohexa-2,4-diene-1-sulfonamide |
| SMILES | Nc1ncc(C2=CC(C3CCC(O)CC3)(S(N)(=O)=O)C(Cl)C=C2)nc1C(=O)c1cccnc1 |
| InChI | InChI=1S/C22H24ClN5O4S/c23-18-8-3-13(10-22(18,33(25,31)32)15-4-6-16(29)7-5-15)17-12-27-21(24)19(28-17)20(30)14-2-1-9-26-11-14/h1-3,8-12,15-16,18,29H,4-7H2,(H2,24,27)(H2,25,31,32) |
| InChIKey | YOCMPMAAQQEMHZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 162.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.99 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|