C29H35N7O2 — CID 151414123
4-[4-[7-amino-3-[3-(4-ethylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]butyl carbamate (PubChem CID 151414123) has the molecular formula C29H35N7O2 and a molecular weight of 513.65 g/mol. Its IUPAC name is 4-[4-[7-amino-3-[3-(4-ethylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]butyl carbamate.
| Compound Name | 4-[4-[7-amino-3-[3-(4-ethylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]butyl carbamate |
|---|---|
| PubChem CID | 151414123 |
| Molecular Formula | C29H35N7O2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | 4-[4-[7-amino-3-[3-(4-ethylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-6-yl]phenyl]butyl carbamate |
| SMILES | CCN1CCN(c2cccc(-c3cnn4c(N)c(-c5ccc(CCCCOC(N)=O)cc5)cnc34)c2)CC1 |
| InChI | InChI=1S/C29H35N7O2/c1-2-34-13-15-35(16-14-34)24-8-5-7-23(18-24)26-20-33-36-27(30)25(19-32-28(26)36)22-11-9-21(10-12-22)6-3-4-17-38-29(31)37/h5,7-12,18-20H,2-4,6,13-17,30H2,1H3,(H2,31,37) |
| InChIKey | OZDHGRSZLMYJSH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 115.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|