C28H35N9 — CID 68705646
6-(4-aminophenyl)-3-[3,5-bis(4-methylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 68705646) has the molecular formula C28H35N9 and a molecular weight of 497.65 g/mol. Its IUPAC name is 6-(4-aminophenyl)-3-[3,5-bis(4-methylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 6-(4-aminophenyl)-3-[3,5-bis(4-methylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 68705646 |
| Molecular Formula | C28H35N9 |
| Molecular Weight | 497.65 g/mol |
| Exact Mass | 497.30 |
| IUPAC Name | 6-(4-aminophenyl)-3-[3,5-bis(4-methylpiperazin-1-yl)phenyl]pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CN1CCN(c2cc(-c3cnn4c(N)c(-c5ccc(N)cc5)cnc34)cc(N3CCN(C)CC3)c2)CC1 |
| InChI | InChI=1S/C28H35N9/c1-33-7-11-35(12-8-33)23-15-21(16-24(17-23)36-13-9-34(2)10-14-36)26-19-32-37-27(30)25(18-31-28(26)37)20-3-5-22(29)6-4-20/h3-6,15-19H,7-14,29-30H2,1-2H3 |
| InChIKey | LXQMEBHICDLEAU-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 95.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|