C17H23N3O6S — CID 15142118
2-(2-aminophenyl)sulfonyl-1,3-dimorpholin-4-ylpropane-1,3-dione (PubChem CID 15142118) has the molecular formula C17H23N3O6S and a molecular weight of 397.45 g/mol. Its IUPAC name is 2-(2-aminophenyl)sulfonyl-1,3-dimorpholin-4-ylpropane-1,3-dione.
| Compound Name | 2-(2-aminophenyl)sulfonyl-1,3-dimorpholin-4-ylpropane-1,3-dione |
|---|---|
| PubChem CID | 15142118 |
| Molecular Formula | C17H23N3O6S |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 2-(2-aminophenyl)sulfonyl-1,3-dimorpholin-4-ylpropane-1,3-dione |
| SMILES | Nc1ccccc1S(=O)(=O)C(C(=O)N1CCOCC1)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C17H23N3O6S/c18-13-3-1-2-4-14(13)27(23,24)15(16(21)19-5-9-25-10-6-19)17(22)20-7-11-26-12-8-20/h1-4,15H,5-12,18H2 |
| InChIKey | GEZUUFZAHCIQTJ-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|