C20H19N5OS — CID 151422375
N-[4-[[2-amino-5-(4-methylthiophen-2-yl)-3-pyridinyl]iminomethyl]-2-pyridinyl]cyclopropanecarboxamide (PubChem CID 151422375) has the molecular formula C20H19N5OS and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[4-[[2-amino-5-(4-methylthiophen-2-yl)-3-pyridinyl]iminomethyl]-2-pyridinyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[2-amino-5-(4-methylthiophen-2-yl)-3-pyridinyl]iminomethyl]-2-pyridinyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 151422375 |
| Molecular Formula | C20H19N5OS |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N-[4-[[2-amino-5-(4-methylthiophen-2-yl)-3-pyridinyl]iminomethyl]-2-pyridinyl]cyclopropanecarboxamide |
| SMILES | Cc1csc(-c2cnc(N)c(/N=C/c3ccnc(NC(=O)C4CC4)c3)c2)c1 |
| InChI | InChI=1S/C20H19N5OS/c1-12-6-17(27-11-12)15-8-16(19(21)24-10-15)23-9-13-4-5-22-18(7-13)25-20(26)14-2-3-14/h4-11,14H,2-3H2,1H3,(H2,21,24)(H,22,25,26)/b23-9+ |
| InChIKey | PAUUDXGWLDDBGV-NUGSKGIGSA-N |
| XLogP | 4.19 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|