C8H15NO3 — CID 151434062
6-hydroxy-2-methylazepane-1-carboxylic acid (PubChem CID 151434062) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is 6-hydroxy-2-methylazepane-1-carboxylic acid.
| Compound Name | 6-hydroxy-2-methylazepane-1-carboxylic acid |
|---|---|
| PubChem CID | 151434062 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 6-hydroxy-2-methylazepane-1-carboxylic acid |
| SMILES | CC1CCCC(O)CN1C(=O)O |
| InChI | InChI=1S/C8H15NO3/c1-6-3-2-4-7(10)5-9(6)8(11)12/h6-7,10H,2-5H2,1H3,(H,11,12) |
| InChIKey | PDCUAAZZMDMYOR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |