C7H9F2N2O5S- — CID 151438662
[(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate (PubChem CID 151438662) has the molecular formula C7H9F2N2O5S- and a molecular weight of 271.22 g/mol. Its IUPAC name is [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate.
| Compound Name | [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
|---|---|
| PubChem CID | 151438662 |
| Molecular Formula | C7H9F2N2O5S- |
| Molecular Weight | 271.22 g/mol |
| Exact Mass | 271.02 |
| IUPAC Name | [(2S,5R)-2-(difluoromethyl)-7-oxo-1,6-diazabicyclo[3.2.1]octan-6-yl] sulfate |
| SMILES | O=C1N2C[C@@H](CC[C@H]2C(F)F)N1OS(=O)(=O)[O-] |
| InChI | InChI=1S/C7H10F2N2O5S/c8-6(9)5-2-1-4-3-10(5)7(12)11(4)16-17(13,14)15/h4-6H,1-3H2,(H,13,14,15)/p-1/t4-,5+/m1/s1 |
| InChIKey | PEAXYUGUBUTXNT-UHNVWZDZSA-M |
| XLogP | -0.09 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|