C15H17F2N — CID 151445093
1-(2,4-difluorophenyl)-2,5-diethyl-2H-pyridine (PubChem CID 151445093) has the molecular formula C15H17F2N and a molecular weight of 249.30 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-2,5-diethyl-2H-pyridine.
| Compound Name | 1-(2,4-difluorophenyl)-2,5-diethyl-2H-pyridine |
|---|---|
| PubChem CID | 151445093 |
| Molecular Formula | C15H17F2N |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 1-(2,4-difluorophenyl)-2,5-diethyl-2H-pyridine |
| SMILES | CCC1=CN(c2ccc(F)cc2F)C(CC)C=C1 |
| InChI | InChI=1S/C15H17F2N/c1-3-11-5-7-13(4-2)18(10-11)15-8-6-12(16)9-14(15)17/h5-10,13H,3-4H2,1-2H3 |
| InChIKey | KKVFGTFUKHCGGY-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |