C9H7Cl2N — CID 151460681
3,6-dichloro-4-methyl-1H-indole (PubChem CID 151460681) has the molecular formula C9H7Cl2N and a molecular weight of 200.07 g/mol. Its IUPAC name is 3,6-dichloro-4-methyl-1H-indole.
| Compound Name | 3,6-dichloro-4-methyl-1H-indole |
|---|---|
| PubChem CID | 151460681 |
| Molecular Formula | C9H7Cl2N |
| Molecular Weight | 200.07 g/mol |
| Exact Mass | 199.00 |
| IUPAC Name | 3,6-dichloro-4-methyl-1H-indole |
| SMILES | Cc1cc(Cl)cc2[nH]cc(Cl)c12 |
| InChI | InChI=1S/C9H7Cl2N/c1-5-2-6(10)3-8-9(5)7(11)4-12-8/h2-4,12H,1H3 |
| InChIKey | PIJPPURIRYRFML-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.07 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |