C14H15Cl2NO — CID 103427821
1-(4,6-dichloro-1H-indol-3-yl)-3,3-dimethylbutan-1-one (PubChem CID 103427821) has the molecular formula C14H15Cl2NO and a molecular weight of 284.19 g/mol. Its IUPAC name is 1-(4,6-dichloro-1H-indol-3-yl)-3,3-dimethylbutan-1-one.
| Compound Name | 1-(4,6-dichloro-1H-indol-3-yl)-3,3-dimethylbutan-1-one |
|---|---|
| PubChem CID | 103427821 |
| Molecular Formula | C14H15Cl2NO |
| Molecular Weight | 284.19 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 1-(4,6-dichloro-1H-indol-3-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)c1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C14H15Cl2NO/c1-14(2,3)6-12(18)9-7-17-11-5-8(15)4-10(16)13(9)11/h4-5,7,17H,6H2,1-3H3 |
| InChIKey | IKGMYFINZUWBSW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.19 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |