C15H8BrCl2NO — CID 103427878
(4-bromophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone (PubChem CID 103427878) has the molecular formula C15H8BrCl2NO and a molecular weight of 369.05 g/mol. Its IUPAC name is (4-bromophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone.
| Compound Name | (4-bromophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 103427878 |
| Molecular Formula | C15H8BrCl2NO |
| Molecular Weight | 369.05 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | (4-bromophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone |
| SMILES | O=C(c1ccc(Br)cc1)c1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C15H8BrCl2NO/c16-9-3-1-8(2-4-9)15(20)11-7-19-13-6-10(17)5-12(18)14(11)13/h1-7,19H |
| InChIKey | HUTSVROQPROARM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.05 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |