C15H8Cl2FNO — CID 103427771
(4,6-dichloro-1H-indol-3-yl)-(2-fluorophenyl)methanone (PubChem CID 103427771) has the molecular formula C15H8Cl2FNO and a molecular weight of 308.14 g/mol. Its IUPAC name is (4,6-dichloro-1H-indol-3-yl)-(2-fluorophenyl)methanone.
| Compound Name | (4,6-dichloro-1H-indol-3-yl)-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 103427771 |
| Molecular Formula | C15H8Cl2FNO |
| Molecular Weight | 308.14 g/mol |
| Exact Mass | 307.00 |
| IUPAC Name | (4,6-dichloro-1H-indol-3-yl)-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)c1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C15H8Cl2FNO/c16-8-5-11(17)14-10(7-19-13(14)6-8)15(20)9-3-1-2-4-12(9)18/h1-7,19H |
| InChIKey | PAQNVPNRKWTGFK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |