C15H8Cl2INO — CID 103427836
(4,6-dichloro-1H-indol-3-yl)-(4-iodophenyl)methanone (PubChem CID 103427836) has the molecular formula C15H8Cl2INO and a molecular weight of 416.05 g/mol. Its IUPAC name is (4,6-dichloro-1H-indol-3-yl)-(4-iodophenyl)methanone.
| Compound Name | (4,6-dichloro-1H-indol-3-yl)-(4-iodophenyl)methanone |
|---|---|
| PubChem CID | 103427836 |
| Molecular Formula | C15H8Cl2INO |
| Molecular Weight | 416.05 g/mol |
| Exact Mass | 414.90 |
| IUPAC Name | (4,6-dichloro-1H-indol-3-yl)-(4-iodophenyl)methanone |
| SMILES | O=C(c1ccc(I)cc1)c1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C15H8Cl2INO/c16-9-5-12(17)14-11(7-19-13(14)6-9)15(20)8-1-3-10(18)4-2-8/h1-7,19H |
| InChIKey | GVMVQSKKJLXCHI-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|