C15H9Cl3N2O — CID 103428602
(2-amino-3-chlorophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone (PubChem CID 103428602) has the molecular formula C15H9Cl3N2O and a molecular weight of 339.61 g/mol. Its IUPAC name is (2-amino-3-chlorophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone.
| Compound Name | (2-amino-3-chlorophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 103428602 |
| Molecular Formula | C15H9Cl3N2O |
| Molecular Weight | 339.61 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | (2-amino-3-chlorophenyl)-(4,6-dichloro-1H-indol-3-yl)methanone |
| SMILES | Nc1c(Cl)cccc1C(=O)c1c[nH]c2cc(Cl)cc(Cl)c12 |
| InChI | InChI=1S/C15H9Cl3N2O/c16-7-4-11(18)13-9(6-20-12(13)5-7)15(21)8-2-1-3-10(17)14(8)19/h1-6,20H,19H2 |
| InChIKey | VHKJBYLMFCHCNA-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|