C14H14Cl2N2O — CID 103427955
(4,6-dichloro-1H-indol-3-yl)-piperidin-4-ylmethanone (PubChem CID 103427955) has the molecular formula C14H14Cl2N2O and a molecular weight of 297.19 g/mol. Its IUPAC name is (4,6-dichloro-1H-indol-3-yl)-piperidin-4-ylmethanone.
| Compound Name | (4,6-dichloro-1H-indol-3-yl)-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 103427955 |
| Molecular Formula | C14H14Cl2N2O |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (4,6-dichloro-1H-indol-3-yl)-piperidin-4-ylmethanone |
| SMILES | O=C(c1c[nH]c2cc(Cl)cc(Cl)c12)C1CCNCC1 |
| InChI | InChI=1S/C14H14Cl2N2O/c15-9-5-11(16)13-10(7-18-12(13)6-9)14(19)8-1-3-17-4-2-8/h5-8,17-18H,1-4H2 |
| InChIKey | WMLJYLIZXVXNGH-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |