C16H17BrN2O3 — CID 151482557
[4-(2-bromoethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 151482557) has the molecular formula C16H17BrN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is [4-(2-bromoethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | [4-(2-bromoethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 151482557 |
| Molecular Formula | C16H17BrN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [4-(2-bromoethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)Oc2cc(CCBr)ccn2)cc1 |
| InChI | InChI=1S/C16H17BrN2O3/c1-21-14-4-2-13(3-5-14)11-19-16(20)22-15-10-12(6-8-17)7-9-18-15/h2-5,7,9-10H,6,8,11H2,1H3,(H,19,20) |
| InChIKey | PMTYLRFFPWGRSB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|