C15H15FN2O4 — CID 135154247
[5-fluoro-4-(hydroxymethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 135154247) has the molecular formula C15H15FN2O4 and a molecular weight of 306.29 g/mol. Its IUPAC name is [5-fluoro-4-(hydroxymethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | [5-fluoro-4-(hydroxymethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 135154247 |
| Molecular Formula | C15H15FN2O4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | [5-fluoro-4-(hydroxymethyl)-2-pyridinyl] N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CNC(=O)Oc2cc(CO)c(F)cn2)cc1 |
| InChI | InChI=1S/C15H15FN2O4/c1-21-12-4-2-10(3-5-12)7-18-15(20)22-14-6-11(9-19)13(16)8-17-14/h2-6,8,19H,7,9H2,1H3,(H,18,20) |
| InChIKey | IFJUQIFNHQDWNO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |