C19H20ClF2NO3S — CID 151489897
2-chloro-1-[3-[3-(difluoromethoxy)phenyl]sulfonylphenyl]-4-methylpiperidine (PubChem CID 151489897) has the molecular formula C19H20ClF2NO3S and a molecular weight of 415.89 g/mol. Its IUPAC name is 2-chloro-1-[3-[3-(difluoromethoxy)phenyl]sulfonylphenyl]-4-methylpiperidine.
| Compound Name | 2-chloro-1-[3-[3-(difluoromethoxy)phenyl]sulfonylphenyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 151489897 |
| Molecular Formula | C19H20ClF2NO3S |
| Molecular Weight | 415.89 g/mol |
| Exact Mass | 415.08 |
| IUPAC Name | 2-chloro-1-[3-[3-(difluoromethoxy)phenyl]sulfonylphenyl]-4-methylpiperidine |
| SMILES | CC1CCN(c2cccc(S(=O)(=O)c3cccc(OC(F)F)c3)c2)C(Cl)C1 |
| InChI | InChI=1S/C19H20ClF2NO3S/c1-13-8-9-23(18(20)10-13)14-4-2-6-16(11-14)27(24,25)17-7-3-5-15(12-17)26-19(21)22/h2-7,11-13,18-19H,8-10H2,1H3 |
| InChIKey | POFXDNQWHVQTNJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.89 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|