C21H25F3N2O4S — CID 74223287
1-[5-[3-(difluoromethoxy)phenyl]sulfonyl-2-(3-fluoropropoxy)phenyl]-4-methylpiperazine (PubChem CID 74223287) has the molecular formula C21H25F3N2O4S and a molecular weight of 458.50 g/mol. Its IUPAC name is 1-[5-[3-(difluoromethoxy)phenyl]sulfonyl-2-(3-fluoropropoxy)phenyl]-4-methylpiperazine.
| Compound Name | 1-[5-[3-(difluoromethoxy)phenyl]sulfonyl-2-(3-fluoropropoxy)phenyl]-4-methylpiperazine |
|---|---|
| PubChem CID | 74223287 |
| Molecular Formula | C21H25F3N2O4S |
| Molecular Weight | 458.50 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | 1-[5-[3-(difluoromethoxy)phenyl]sulfonyl-2-(3-fluoropropoxy)phenyl]-4-methylpiperazine |
| SMILES | CN1CCN(c2cc(S(=O)(=O)c3cccc(OC(F)F)c3)ccc2OCCCF)CC1 |
| InChI | InChI=1S/C21H25F3N2O4S/c1-25-9-11-26(12-10-25)19-15-18(6-7-20(19)29-13-3-8-22)31(27,28)17-5-2-4-16(14-17)30-21(23)24/h2,4-7,14-15,21H,3,8-13H2,1H3 |
| InChIKey | MYIBBELKQOIJGZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.50 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|