C15H24F2N2O2 — CID 151496225
10-[3-(difluoromethyl)-1-methylpyrazol-4-yl]decanoic acid (PubChem CID 151496225) has the molecular formula C15H24F2N2O2 and a molecular weight of 302.36 g/mol. Its IUPAC name is 10-[3-(difluoromethyl)-1-methylpyrazol-4-yl]decanoic acid.
| Compound Name | 10-[3-(difluoromethyl)-1-methylpyrazol-4-yl]decanoic acid |
|---|---|
| PubChem CID | 151496225 |
| Molecular Formula | C15H24F2N2O2 |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 10-[3-(difluoromethyl)-1-methylpyrazol-4-yl]decanoic acid |
| SMILES | Cn1cc(CCCCCCCCCC(=O)O)c(C(F)F)n1 |
| InChI | InChI=1S/C15H24F2N2O2/c1-19-11-12(14(18-19)15(16)17)9-7-5-3-2-4-6-8-10-13(20)21/h11,15H,2-10H2,1H3,(H,20,21) |
| InChIKey | PPMCCAYHWFWLSC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|