C11H21N3O — CID 151497719
N-(2,2,6,6-tetramethylpiperazin-1-yl)prop-2-enamide (PubChem CID 151497719) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperazin-1-yl)prop-2-enamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 151497719 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperazin-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)NN1C(C)(C)CNCC1(C)C |
| InChI | InChI=1S/C11H21N3O/c1-6-9(15)13-14-10(2,3)7-12-8-11(14,4)5/h6,12H,1,7-8H2,2-5H3,(H,13,15) |
| InChIKey | PPTJZGIKHRRVBY-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|