C12H23N3O — CID 150213116
N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide (PubChem CID 150213116) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide.
| Compound Name | N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 150213116 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide |
| SMILES | C=CC(=O)NN1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H23N3O/c1-7-10(16)13-15-8-11(2,3)14(6)12(4,5)9-15/h7H,1,8-9H2,2-6H3,(H,13,16) |
| InChIKey | FRXHRVAASKJAFO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|