C13H25N3O — CID 139944535
2-methyl-N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide (PubChem CID 139944535) has the molecular formula C13H25N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-methyl-N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide.
| Compound Name | 2-methyl-N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139944535 |
| Molecular Formula | C13H25N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | 2-methyl-N-(3,3,4,5,5-pentamethylpiperazin-1-yl)prop-2-enamide |
| SMILES | C=C(C)C(=O)NN1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C13H25N3O/c1-10(2)11(17)14-16-8-12(3,4)15(7)13(5,6)9-16/h1,8-9H2,2-7H3,(H,14,17) |
| InChIKey | JCZDULRXPYNIOY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|