C27H23NO2 — CID 151503347
6-(2-cyclopropylethynyl)-3,4-bis(phenylmethoxy)-1H-indole (PubChem CID 151503347) has the molecular formula C27H23NO2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 6-(2-cyclopropylethynyl)-3,4-bis(phenylmethoxy)-1H-indole.
| Compound Name | 6-(2-cyclopropylethynyl)-3,4-bis(phenylmethoxy)-1H-indole |
|---|---|
| PubChem CID | 151503347 |
| Molecular Formula | C27H23NO2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | 6-(2-cyclopropylethynyl)-3,4-bis(phenylmethoxy)-1H-indole |
| SMILES | C(#CC1CC1)c1cc(OCc2ccccc2)c2c(OCc3ccccc3)c[nH]c2c1 |
| InChI | InChI=1S/C27H23NO2/c1-3-7-21(8-4-1)18-29-25-16-23(14-13-20-11-12-20)15-24-27(25)26(17-28-24)30-19-22-9-5-2-6-10-22/h1-10,15-17,20,28H,11-12,18-19H2 |
| InChIKey | PQWXZLKLNAAWEB-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|