C29H27NO2 — CID 151304700
6-(2-cyclopentylethynyl)-3,4-bis(phenylmethoxy)-1H-indole (PubChem CID 151304700) has the molecular formula C29H27NO2 and a molecular weight of 421.54 g/mol. Its IUPAC name is 6-(2-cyclopentylethynyl)-3,4-bis(phenylmethoxy)-1H-indole.
| Compound Name | 6-(2-cyclopentylethynyl)-3,4-bis(phenylmethoxy)-1H-indole |
|---|---|
| PubChem CID | 151304700 |
| Molecular Formula | C29H27NO2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 6-(2-cyclopentylethynyl)-3,4-bis(phenylmethoxy)-1H-indole |
| SMILES | C(#CC1CCCC1)c1cc(OCc2ccccc2)c2c(OCc3ccccc3)c[nH]c2c1 |
| InChI | InChI=1S/C29H27NO2/c1-3-11-23(12-4-1)20-31-27-18-25(16-15-22-9-7-8-10-22)17-26-29(27)28(19-30-26)32-21-24-13-5-2-6-14-24/h1-6,11-14,17-19,22,30H,7-10,20-21H2 |
| InChIKey | ODDRWFLZYZZMQX-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 34.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|