C19H22BrNO — CID 172650668
4-bromo-N-cyclohexyl-3-phenylmethoxyaniline (PubChem CID 172650668) has the molecular formula C19H22BrNO and a molecular weight of 360.30 g/mol. Its IUPAC name is 4-bromo-N-cyclohexyl-3-phenylmethoxyaniline.
| Compound Name | 4-bromo-N-cyclohexyl-3-phenylmethoxyaniline |
|---|---|
| PubChem CID | 172650668 |
| Molecular Formula | C19H22BrNO |
| Molecular Weight | 360.30 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | 4-bromo-N-cyclohexyl-3-phenylmethoxyaniline |
| SMILES | Brc1ccc(NC2CCCCC2)cc1OCc1ccccc1 |
| InChI | InChI=1S/C19H22BrNO/c20-18-12-11-17(21-16-9-5-2-6-10-16)13-19(18)22-14-15-7-3-1-4-8-15/h1,3-4,7-8,11-13,16,21H,2,5-6,9-10,14H2 |
| InChIKey | ZAXQMOLCTSXXNV-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.30 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |