C22H40O2 — CID 151511488
(2E)-2-(10,10-dimethylundecoxymethylidene)-4,4-dimethylcyclohexan-1-one (PubChem CID 151511488) has the molecular formula C22H40O2 and a molecular weight of 336.56 g/mol. Its IUPAC name is (2E)-2-(10,10-dimethylundecoxymethylidene)-4,4-dimethylcyclohexan-1-one.
| Compound Name | (2E)-2-(10,10-dimethylundecoxymethylidene)-4,4-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 151511488 |
| Molecular Formula | C22H40O2 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 336.30 |
| IUPAC Name | (2E)-2-(10,10-dimethylundecoxymethylidene)-4,4-dimethylcyclohexan-1-one |
| SMILES | CC(C)(C)CCCCCCCCCO/C=C1\CC(C)(C)CCC1=O |
| InChI | InChI=1S/C22H40O2/c1-21(2,3)14-11-9-7-6-8-10-12-16-24-18-19-17-22(4,5)15-13-20(19)23/h18H,6-17H2,1-5H3/b19-18+ |
| InChIKey | PSOLDYQSVRESFA-VHEBQXMUSA-N |
| XLogP | 6.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|