C25H46O2 — CID 172710884
(2E)-4,4-dimethyl-2-(10,10,11,11-tetramethyldodecoxymethylidene)cyclohexan-1-one (PubChem CID 172710884) has the molecular formula C25H46O2 and a molecular weight of 378.64 g/mol. Its IUPAC name is (2E)-4,4-dimethyl-2-(10,10,11,11-tetramethyldodecoxymethylidene)cyclohexan-1-one.
| Compound Name | (2E)-4,4-dimethyl-2-(10,10,11,11-tetramethyldodecoxymethylidene)cyclohexan-1-one |
|---|---|
| PubChem CID | 172710884 |
| Molecular Formula | C25H46O2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.35 |
| IUPAC Name | (2E)-4,4-dimethyl-2-(10,10,11,11-tetramethyldodecoxymethylidene)cyclohexan-1-one |
| SMILES | CC1(C)CCC(=O)/C(=C/OCCCCCCCCCC(C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C25H46O2/c1-23(2,3)25(6,7)16-13-11-9-8-10-12-14-18-27-20-21-19-24(4,5)17-15-22(21)26/h20H,8-19H2,1-7H3/b21-20+ |
| InChIKey | FFPYOFKQRQDPDJ-QZQOTICOSA-N |
| XLogP | 7.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|