C18H26O — CID 15151944
trans-(1R,5R)-5-methyl-1-(2-phenylethyl)-2-propan-2-ylidenecyclohexan-1-ol (PubChem CID 15151944) has the molecular formula C18H26O and a molecular weight of 258.40 g/mol. Its IUPAC name is trans-(1R,5R)-5-methyl-1-(2-phenylethyl)-2-propan-2-ylidenecyclohexan-1-ol.
| Compound Name | trans-(1R,5R)-5-methyl-1-(2-phenylethyl)-2-propan-2-ylidenecyclohexan-1-ol |
|---|---|
| PubChem CID | 15151944 |
| Molecular Formula | C18H26O |
| Molecular Weight | 258.40 g/mol |
| Exact Mass | 258.20 |
| IUPAC Name | trans-(1R,5R)-5-methyl-1-(2-phenylethyl)-2-propan-2-ylidenecyclohexan-1-ol |
| SMILES | CC(C)=C1CC[C@@H](C)C[C@]1(O)CCc1ccccc1 |
| InChI | InChI=1S/C18H26O/c1-14(2)17-10-9-15(3)13-18(17,19)12-11-16-7-5-4-6-8-16/h4-8,15,19H,9-13H2,1-3H3/t15-,18-/m1/s1 |
| InChIKey | FDGFKQSBLDYYMW-CRAIPNDOSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.40 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|