C14H19F2NO2 — CID 151521559
4-(difluoromethoxy)-2,6-di(propan-2-yl)benzamide (PubChem CID 151521559) has the molecular formula C14H19F2NO2 and a molecular weight of 271.31 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,6-di(propan-2-yl)benzamide.
| Compound Name | 4-(difluoromethoxy)-2,6-di(propan-2-yl)benzamide |
|---|---|
| PubChem CID | 151521559 |
| Molecular Formula | C14H19F2NO2 |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 4-(difluoromethoxy)-2,6-di(propan-2-yl)benzamide |
| SMILES | CC(C)c1cc(OC(F)F)cc(C(C)C)c1C(N)=O |
| InChI | InChI=1S/C14H19F2NO2/c1-7(2)10-5-9(19-14(15)16)6-11(8(3)4)12(10)13(17)18/h5-8,14H,1-4H3,(H2,17,18) |
| InChIKey | PUOYZPPQKINQPP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |