About 9-ethylsulfanylcarbazole
9-ethylsulfanylcarbazole (PubChem CID 151528824) has the molecular formula C14H13NS
and a molecular weight of 227.33 g/mol. Its IUPAC name is 9-ethylsulfanylcarbazole.
Molecular Properties
| Compound Name | 9-ethylsulfanylcarbazole |
| PubChem CID | 151528824 |
| Molecular Formula | C14H13NS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 9-ethylsulfanylcarbazole |
| SMILES | CCSn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C14H13NS/c1-2-16-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,2H2,1H3 |
| InChIKey | PWAUTFVZMVODJB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-ethylsulfanylcarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylsulfanylcarbazole?
The IUPAC name of 9-ethylsulfanylcarbazole (CID 151528824) is 9-ethylsulfanylcarbazole.
What is the SMILES notation for 9-ethylsulfanylcarbazole?
The canonical SMILES for 9-ethylsulfanylcarbazole is CCSn1c2ccccc2c2ccccc21.
What is the InChIKey of 9-ethylsulfanylcarbazole?
The InChIKey is PWAUTFVZMVODJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS/c1-2-16-15-13-9-5-3-7-11(13)12-8-4-6-10-14(12)15/h3-10H,2H2,1H3.
What are the key properties of 9-ethylsulfanylcarbazole?
9-ethylsulfanylcarbazole has a molecular weight of 227.33 g/mol, XLogP of 4.31, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylsulfanylcarbazole is sourced from PubChem (CID 151528824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).