C26H33NO2 — CID 15152988
tert-butyl 5-(2,2-diphenylethyl)-2,2-dimethyl-4-methylidenepyrrolidine-1-carboxylate (PubChem CID 15152988) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is tert-butyl 5-(2,2-diphenylethyl)-2,2-dimethyl-4-methylidenepyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 5-(2,2-diphenylethyl)-2,2-dimethyl-4-methylidenepyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 15152988 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | tert-butyl 5-(2,2-diphenylethyl)-2,2-dimethyl-4-methylidenepyrrolidine-1-carboxylate |
| SMILES | C=C1CC(C)(C)N(C(=O)OC(C)(C)C)C1CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H33NO2/c1-19-18-26(5,6)27(24(28)29-25(2,3)4)23(19)17-22(20-13-9-7-10-14-20)21-15-11-8-12-16-21/h7-16,22-23H,1,17-18H2,2-6H3 |
| InChIKey | HLXPXBSBXRVJRP-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|