C10H12NO5P — CID 151531580
[2-amino-4-(2-methylprop-2-enoyl)phenyl] dihydrogen phosphate (PubChem CID 151531580) has the molecular formula C10H12NO5P and a molecular weight of 257.18 g/mol. Its IUPAC name is [2-amino-4-(2-methylprop-2-enoyl)phenyl] dihydrogen phosphate.
| Compound Name | [2-amino-4-(2-methylprop-2-enoyl)phenyl] dihydrogen phosphate |
|---|---|
| PubChem CID | 151531580 |
| Molecular Formula | C10H12NO5P |
| Molecular Weight | 257.18 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | [2-amino-4-(2-methylprop-2-enoyl)phenyl] dihydrogen phosphate |
| SMILES | C=C(C)C(=O)c1ccc(OP(=O)(O)O)c(N)c1 |
| InChI | InChI=1S/C10H12NO5P/c1-6(2)10(12)7-3-4-9(8(11)5-7)16-17(13,14)15/h3-5H,1,11H2,2H3,(H2,13,14,15) |
| InChIKey | PWOYSLRWZOKVNX-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|