C13H17O6P — CID 22708503
2-(5-methyl-2-phosphonooxyphenyl)ethyl 2-methylprop-2-enoate (PubChem CID 22708503) has the molecular formula C13H17O6P and a molecular weight of 300.25 g/mol. Its IUPAC name is 2-(5-methyl-2-phosphonooxyphenyl)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(5-methyl-2-phosphonooxyphenyl)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 22708503 |
| Molecular Formula | C13H17O6P |
| Molecular Weight | 300.25 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(5-methyl-2-phosphonooxyphenyl)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCc1cc(C)ccc1OP(=O)(O)O |
| InChI | InChI=1S/C13H17O6P/c1-9(2)13(14)18-7-6-11-8-10(3)4-5-12(11)19-20(15,16)17/h4-5,8H,1,6-7H2,2-3H3,(H2,15,16,17) |
| InChIKey | IEKAHDJEBYWOJS-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.25 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|