C13H16O6P+ — CID 174909275
hydroxy-[4-methoxy-2-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]-oxophosphanium (PubChem CID 174909275) has the molecular formula C13H16O6P+ and a molecular weight of 299.24 g/mol. Its IUPAC name is hydroxy-[4-methoxy-2-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]-oxophosphanium.
| Compound Name | hydroxy-[4-methoxy-2-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]-oxophosphanium |
|---|---|
| PubChem CID | 174909275 |
| Molecular Formula | C13H16O6P+ |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | hydroxy-[4-methoxy-2-[2-(2-methylprop-2-enoyloxy)ethyl]phenoxy]-oxophosphanium |
| SMILES | C=C(C)C(=O)OCCc1cc(OC)ccc1O[P+](=O)O |
| InChI | InChI=1S/C13H15O6P/c1-9(2)13(14)18-7-6-10-8-11(17-3)4-5-12(10)19-20(15)16/h4-5,8H,1,6-7H2,2-3H3/p+1 |
| InChIKey | IRXFYSZGUWEKKB-UHFFFAOYSA-O |
| XLogP | 2.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|