C26H17ClF5N3O4 — CID 151533168
3-chloro-N-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-2-(trifluoromethyl)benzamide (PubChem CID 151533168) has the molecular formula C26H17ClF5N3O4 and a molecular weight of 565.88 g/mol. Its IUPAC name is 3-chloro-N-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-2-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 151533168 |
| Molecular Formula | C26H17ClF5N3O4 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 3-chloro-N-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-2-(trifluoromethyl)benzamide |
| SMILES | COCCOc1cnc2ccc(C(=O)c3c(F)ccc(NC(=O)c4cccc(Cl)c4C(F)(F)F)c3F)cc2n1 |
| InChI | InChI=1S/C26H17ClF5N3O4/c1-38-9-10-39-20-12-33-17-7-5-13(11-19(17)34-20)24(36)21-16(28)6-8-18(23(21)29)35-25(37)14-3-2-4-15(27)22(14)26(30,31)32/h2-8,11-12H,9-10H2,1H3,(H,35,37) |
| InChIKey | PWXDIAGIQLZXNL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|