C25H19F3N4O4 — CID 89443748
1-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-3-(3-fluorophenyl)urea (PubChem CID 89443748) has the molecular formula C25H19F3N4O4 and a molecular weight of 496.45 g/mol. Its IUPAC name is 1-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 89443748 |
| Molecular Formula | C25H19F3N4O4 |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | 1-[2,4-difluoro-3-[3-(2-methoxyethoxy)quinoxaline-6-carbonyl]phenyl]-3-(3-fluorophenyl)urea |
| SMILES | COCCOc1cnc2ccc(C(=O)c3c(F)ccc(NC(=O)Nc4cccc(F)c4)c3F)cc2n1 |
| InChI | InChI=1S/C25H19F3N4O4/c1-35-9-10-36-21-13-29-18-7-5-14(11-20(18)31-21)24(33)22-17(27)6-8-19(23(22)28)32-25(34)30-16-4-2-3-15(26)12-16/h2-8,11-13H,9-10H2,1H3,(H2,30,32,34) |
| InChIKey | QBEROCWIBMJPGO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|