C20H26O2 — CID 15153337
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hex-5-yn-1-one (PubChem CID 15153337) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hex-5-yn-1-one.
| Compound Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hex-5-yn-1-one |
|---|---|
| PubChem CID | 15153337 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)hex-5-yn-1-one |
| SMILES | C#CCCCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C20H26O2/c1-7-8-9-10-17(21)14-11-15(19(2,3)4)18-16(12-14)20(5,6)13-22-18/h1,11-12H,8-10,13H2,2-6H3 |
| InChIKey | LMLIBGCGVNECIP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|