C19H27ClO2 — CID 10381501
1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-chloro-3-methylbutan-1-one (PubChem CID 10381501) has the molecular formula C19H27ClO2 and a molecular weight of 322.88 g/mol. Its IUPAC name is 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-chloro-3-methylbutan-1-one.
| Compound Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-chloro-3-methylbutan-1-one |
|---|---|
| PubChem CID | 10381501 |
| Molecular Formula | C19H27ClO2 |
| Molecular Weight | 322.88 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-(7-tert-butyl-3,3-dimethyl-2H-1-benzofuran-5-yl)-3-chloro-3-methylbutan-1-one |
| SMILES | CC(C)(Cl)CC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CO2 |
| InChI | InChI=1S/C19H27ClO2/c1-17(2,3)13-8-12(15(21)10-19(6,7)20)9-14-16(13)22-11-18(14,4)5/h8-9H,10-11H2,1-7H3 |
| InChIKey | NPNBSWGEGKXDPD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.88 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|