C9H15N5 — CID 151535013
3-(4-methylpiperidin-1-yl)-1,2,4-triazin-5-amine (PubChem CID 151535013) has the molecular formula C9H15N5 and a molecular weight of 193.25 g/mol. Its IUPAC name is 3-(4-methylpiperidin-1-yl)-1,2,4-triazin-5-amine.
| Compound Name | 3-(4-methylpiperidin-1-yl)-1,2,4-triazin-5-amine |
|---|---|
| PubChem CID | 151535013 |
| Molecular Formula | C9H15N5 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 3-(4-methylpiperidin-1-yl)-1,2,4-triazin-5-amine |
| SMILES | CC1CCN(c2nncc(N)n2)CC1 |
| InChI | InChI=1S/C9H15N5/c1-7-2-4-14(5-3-7)9-12-8(10)6-11-13-9/h6-7H,2-5H2,1H3,(H2,10,12,13) |
| InChIKey | PXGVULJATQAJOR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 67.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |