C17H19F3N6O — CID 151552270
2-[[9-ethyl-8-[[4-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]ethanol (PubChem CID 151552270) has the molecular formula C17H19F3N6O and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-[[9-ethyl-8-[[4-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]ethanol.
| Compound Name | 2-[[9-ethyl-8-[[4-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 151552270 |
| Molecular Formula | C17H19F3N6O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-[[9-ethyl-8-[[4-(trifluoromethyl)phenyl]methylamino]purin-2-yl]amino]ethanol |
| SMILES | CCn1c(NCc2ccc(C(F)(F)F)cc2)nc2cnc(NCCO)nc21 |
| InChI | InChI=1S/C17H19F3N6O/c1-2-26-14-13(10-22-15(25-14)21-7-8-27)24-16(26)23-9-11-3-5-12(6-4-11)17(18,19)20/h3-6,10,27H,2,7-9H2,1H3,(H,23,24)(H,21,22,25) |
| InChIKey | QASWUJIOKHOKDR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |