C19H32O2 — CID 151559267
1-(1-methoxy-2,3-dimethylcyclohexa-2,5-dien-1-yl)decan-1-one (PubChem CID 151559267) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is 1-(1-methoxy-2,3-dimethylcyclohexa-2,5-dien-1-yl)decan-1-one.
| Compound Name | 1-(1-methoxy-2,3-dimethylcyclohexa-2,5-dien-1-yl)decan-1-one |
|---|---|
| PubChem CID | 151559267 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | 1-(1-methoxy-2,3-dimethylcyclohexa-2,5-dien-1-yl)decan-1-one |
| SMILES | CCCCCCCCCC(=O)C1(OC)C=CCC(C)=C1C |
| InChI | InChI=1S/C19H32O2/c1-5-6-7-8-9-10-11-14-18(20)19(21-4)15-12-13-16(2)17(19)3/h12,15H,5-11,13-14H2,1-4H3 |
| InChIKey | QCCYSXFUPRZHTL-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|